C31H27Cl2N3O2 — CID 3374190
5-[(3,5-dichlorobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide (PubChem CID 3374190) has the molecular formula C31H27Cl2N3O2 and a molecular weight of 544.48 g/mol. Its IUPAC name is 5-[(3,5-dichlorobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide.
| Compound Name | 5-[(3,5-dichlorobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 3374190 |
| Molecular Formula | C31H27Cl2N3O2 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 5-[(3,5-dichlorobenzoyl)amino]-2-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(2-phenylethyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCc3ccccc3C2)c(C(=O)NCCc2ccccc2)c1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C31H27Cl2N3O2/c32-25-16-24(17-26(33)18-25)30(37)35-27-10-11-29(36-15-13-22-8-4-5-9-23(22)20-36)28(19-27)31(38)34-14-12-21-6-2-1-3-7-21/h1-11,16-19H,12-15,20H2,(H,34,38)(H,35,37) |
| InChIKey | QTEPSTDNJHKEEW-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|