C22H30N4O2 — CID 111273955
N-benzyl-3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-methylpropanamide (PubChem CID 111273955) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-benzyl-3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-methylpropanamide.
| Compound Name | N-benzyl-3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 111273955 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | N-benzyl-3-[[N,N'-dimethyl-N-(2-phenoxyethyl)carbamimidoyl]amino]-N-methylpropanamide |
| SMILES | C/N=C(/NCCC(=O)N(C)Cc1ccccc1)N(C)CCOc1ccccc1 |
| InChI | InChI=1S/C22H30N4O2/c1-23-22(25(2)16-17-28-20-12-8-5-9-13-20)24-15-14-21(27)26(3)18-19-10-6-4-7-11-19/h4-13H,14-18H2,1-3H3,(H,23,24) |
| InChIKey | QGZZTHOHQOWYSG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|