C18H27F3N4O — CID 111300243
N-butan-2-yl-3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111300243) has the molecular formula C18H27F3N4O and a molecular weight of 372.44 g/mol. Its IUPAC name is N-butan-2-yl-3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N-butan-2-yl-3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111300243 |
| Molecular Formula | C18H27F3N4O |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-butan-2-yl-3-[[N,N'-dimethyl-N-[[4-(trifluoromethyl)phenyl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | CCC(C)NC(=O)CCN/C(=N\C)N(C)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H27F3N4O/c1-5-13(2)24-16(26)10-11-23-17(22-3)25(4)12-14-6-8-15(9-7-14)18(19,20)21/h6-9,13H,5,10-12H2,1-4H3,(H,22,23)(H,24,26) |
| InChIKey | BVJLKIIBJIHKGG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|