C19H27N5O — CID 111383121
N-tert-butyl-2-[[N'-methyl-N-(2-quinolin-8-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111383121) has the molecular formula C19H27N5O and a molecular weight of 341.46 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-(2-quinolin-8-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-(2-quinolin-8-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383121 |
| Molecular Formula | C19H27N5O |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.22 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-(2-quinolin-8-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCCc1cccc2cccnc12)NCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H27N5O/c1-19(2,3)24-16(25)13-23-18(20-4)22-12-10-15-8-5-7-14-9-6-11-21-17(14)15/h5-9,11H,10,12-13H2,1-4H3,(H,24,25)(H2,20,22,23) |
| InChIKey | UJBOOPJDUMLTCR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|