C16H28IN5O2 — CID 75421235
N-tert-butyl-2-[[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 75421235) has the molecular formula C16H28IN5O2 and a molecular weight of 449.34 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 75421235 |
| Molecular Formula | C16H28IN5O2 |
| Molecular Weight | 449.34 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | N-tert-butyl-2-[[N-[(2-ethoxy-3-pyridinyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCOc1ncccc1CN/C(=N/C)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C16H27N5O2.HI/c1-6-23-14-12(8-7-9-18-14)10-19-15(17-5)20-11-13(22)21-16(2,3)4;/h7-9H,6,10-11H2,1-5H3,(H,21,22)(H2,17,19,20);1H |
| InChIKey | NFUNECCBVWPHJO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.34 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|