C18H21F3N4O2 — CID 111847917
1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine (PubChem CID 111847917) has the molecular formula C18H21F3N4O2 and a molecular weight of 382.39 g/mol. Its IUPAC name is 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111847917 |
| Molecular Formula | C18H21F3N4O2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 1-[(2-ethoxy-3-pyridinyl)methyl]-2-methyl-3-[[2-(trifluoromethoxy)phenyl]methyl]guanidine |
| SMILES | CCOc1ncccc1CN/C(=N\C)NCc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H21F3N4O2/c1-3-26-16-14(8-6-10-23-16)12-25-17(22-2)24-11-13-7-4-5-9-15(13)27-18(19,20)21/h4-10H,3,11-12H2,1-2H3,(H2,22,24,25) |
| InChIKey | WCYBDMAKLAQVSR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|