C16H22F2IN5 — CID 111566770
1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide (PubChem CID 111566770) has the molecular formula C16H22F2IN5 and a molecular weight of 449.29 g/mol. Its IUPAC name is 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111566770 |
| Molecular Formula | C16H22F2IN5 |
| Molecular Weight | 449.29 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-[2-(2,3-difluorophenyl)ethyl]-2-methyl-3-(3-pyrazol-1-ylpropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1cccn1)NCCc1cccc(F)c1F.I |
| InChI | InChI=1S/C16H21F2N5.HI/c1-19-16(20-8-3-11-23-12-4-9-22-23)21-10-7-13-5-2-6-14(17)15(13)18;/h2,4-6,9,12H,3,7-8,10-11H2,1H3,(H2,19,20,21);1H |
| InChIKey | KKMHGSAUWKNUDG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|