C20H37IN6O2 — CID 111278646
tert-butyl N-cyclopropyl-N-[2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111278646) has the molecular formula C20H37IN6O2 and a molecular weight of 520.46 g/mol. Its IUPAC name is tert-butyl N-cyclopropyl-N-[2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-cyclopropyl-N-[2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111278646 |
| Molecular Formula | C20H37IN6O2 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | tert-butyl N-cyclopropyl-N-[2-[[N-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N'-methylcarbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(/NCCCn1nc(C)cc1C)NCCN(C(=O)OC(C)(C)C)C1CC1.I |
| InChI | InChI=1S/C20H36N6O2.HI/c1-15-14-16(2)26(24-15)12-7-10-22-18(21-6)23-11-13-25(17-8-9-17)19(27)28-20(3,4)5;/h14,17H,7-13H2,1-6H3,(H2,21,22,23);1H |
| InChIKey | XJCOTUITYPKUJW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|