C19H37IN6O2 — CID 111280858
tert-butyl N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 111280858) has the molecular formula C19H37IN6O2 and a molecular weight of 508.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111280858 |
| Molecular Formula | C19H37IN6O2 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | tert-butyl N-[2-[[N'-[3-(3,5-dimethylpyrazol-1-yl)propyl]-N-ethylcarbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCN(C)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C19H36N6O2.HI/c1-8-20-17(21-10-9-12-25-16(3)14-15(2)23-25)22-11-13-24(7)18(26)27-19(4,5)6;/h14H,8-13H2,1-7H3,(H2,20,21,22);1H |
| InChIKey | OKRHLVIIBLYLEM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|