C17H33IN6O2 — CID 111905210
tert-butyl N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide (PubChem CID 111905210) has the molecular formula C17H33IN6O2 and a molecular weight of 480.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111905210 |
| Molecular Formula | C17H33IN6O2 |
| Molecular Weight | 480.40 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | tert-butyl N-[2-[[N-ethyl-N'-(3-pyrazol-1-ylpropyl)carbamimidoyl]amino]ethyl]-N-methylcarbamate;hydroiodide |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCN(C)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C17H32N6O2.HI/c1-6-18-15(19-9-7-12-23-13-8-10-21-23)20-11-14-22(5)16(24)25-17(2,3)4;/h8,10,13H,6-7,9,11-12,14H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | JMYSHUBHZRNSOK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|