C15H30N6O2S — CID 111905541
1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111905541) has the molecular formula C15H30N6O2S and a molecular weight of 358.51 g/mol. Its IUPAC name is 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111905541 |
| Molecular Formula | C15H30N6O2S |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | 1-ethyl-3-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CCCn1cccn1)NCCCN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C15H30N6O2S/c1-4-16-15(17-9-6-12-20-13-8-11-19-20)18-10-7-14-21(5-2)24(3,22)23/h8,11,13H,4-7,9-10,12,14H2,1-3H3,(H2,16,17,18) |
| InChIKey | LZEILVQUCHTQBO-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|