C12H20BN3O3SSi — CID 58405547
[5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid (PubChem CID 58405547) has the molecular formula C12H20BN3O3SSi and a molecular weight of 325.27 g/mol. Its IUPAC name is [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid.
| Compound Name | [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid |
|---|---|
| PubChem CID | 58405547 |
| Molecular Formula | C12H20BN3O3SSi |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1ncc(B(O)O)c1-c1nccs1 |
| InChI | InChI=1S/C12H20BN3O3SSi/c1-21(2,3)7-5-19-9-16-11(12-14-4-6-20-12)10(8-15-16)13(17)18/h4,6,8,17-18H,5,7,9H2,1-3H3 |
| InChIKey | AUJLTXZXFIMRHR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|