About [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid
[5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid (PubChem CID 58405547) has the molecular formula C12H20BN3O3SSi
and a molecular weight of 325.27 g/mol. Its IUPAC name is [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid.
Molecular Properties
| Compound Name | [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid |
| PubChem CID | 58405547 |
| Molecular Formula | C12H20BN3O3SSi |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1ncc(B(O)O)c1-c1nccs1 |
| InChI | InChI=1S/C12H20BN3O3SSi/c1-21(2,3)7-5-19-9-16-11(12-14-4-6-20-12)10(8-15-16)13(17)18/h4,6,8,17-18H,5,7,9H2,1-3H3 |
| InChIKey | AUJLTXZXFIMRHR-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid?
The IUPAC name of [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid (CID 58405547) is [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid.
What is the SMILES notation for [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid?
The canonical SMILES for [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid is C[Si](C)(C)CCOCn1ncc(B(O)O)c1-c1nccs1.
What is the InChIKey of [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid?
The InChIKey is AUJLTXZXFIMRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20BN3O3SSi/c1-21(2,3)7-5-19-9-16-11(12-14-4-6-20-12)10(8-15-16)13(17)18/h4,6,8,17-18H,5,7,9H2,1-3H3.
What are the key properties of [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid?
[5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid has a molecular weight of 325.27 g/mol, XLogP of 1.00, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(1,3-thiazol-2-yl)-1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]boronic acid is sourced from PubChem (CID 58405547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).