C21H24FN5O3Si — CID 71283580
2-[6-(fluoromethyl)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 71283580) has the molecular formula C21H24FN5O3Si and a molecular weight of 441.54 g/mol. Its IUPAC name is 2-[6-(fluoromethyl)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-[6-(fluoromethyl)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 71283580 |
| Molecular Formula | C21H24FN5O3Si |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 2-[6-(fluoromethyl)-1H-indazol-3-yl]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1cc(C(=O)O)c2nc(-c3n[nH]c4cc(CF)ccc34)cnc21 |
| InChI | InChI=1S/C21H24FN5O3Si/c1-31(2,3)7-6-30-12-27-11-15(21(28)29)19-20(27)23-10-17(24-19)18-14-5-4-13(9-22)8-16(14)25-26-18/h4-5,8,10-11H,6-7,9,12H2,1-3H3,(H,25,26)(H,28,29) |
| InChIKey | NAYKPOVLKDKKGL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|