C25H32IN3O2Si — CID 67344925
[2-(3-iodophenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-(1-methylcyclopentyl)methanone (PubChem CID 67344925) has the molecular formula C25H32IN3O2Si and a molecular weight of 561.54 g/mol. Its IUPAC name is [2-(3-iodophenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-(1-methylcyclopentyl)methanone.
| Compound Name | [2-(3-iodophenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-(1-methylcyclopentyl)methanone |
|---|---|
| PubChem CID | 67344925 |
| Molecular Formula | C25H32IN3O2Si |
| Molecular Weight | 561.54 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | [2-(3-iodophenyl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazin-7-yl]-(1-methylcyclopentyl)methanone |
| SMILES | CC1(C(=O)c2cn(COCC[Si](C)(C)C)c3ncc(-c4cccc(I)c4)nc23)CCCC1 |
| InChI | InChI=1S/C25H32IN3O2Si/c1-25(10-5-6-11-25)23(30)20-16-29(17-31-12-13-32(2,3)4)24-22(20)28-21(15-27-24)18-8-7-9-19(26)14-18/h7-9,14-16H,5-6,10-13,17H2,1-4H3 |
| InChIKey | LEECZEPRTIMFEC-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.54 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|