C15H11ClN2O2 — CID 58125299
2-[(4-chlorophenyl)methyl]indazole-7-carboxylic acid (PubChem CID 58125299) has the molecular formula C15H11ClN2O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]indazole-7-carboxylic acid.
| Compound Name | 2-[(4-chlorophenyl)methyl]indazole-7-carboxylic acid |
|---|---|
| PubChem CID | 58125299 |
| Molecular Formula | C15H11ClN2O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]indazole-7-carboxylic acid |
| SMILES | O=C(O)c1cccc2cn(Cc3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C15H11ClN2O2/c16-12-6-4-10(5-7-12)8-18-9-11-2-1-3-13(15(19)20)14(11)17-18/h1-7,9H,8H2,(H,19,20) |
| InChIKey | HMGDWHDFJMZVAI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |