C20H33N5O2Si — CID 66889445
4-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]piperidin-4-ol (PubChem CID 66889445) has the molecular formula C20H33N5O2Si and a molecular weight of 403.60 g/mol. Its IUPAC name is 4-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]piperidin-4-ol.
| Compound Name | 4-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 66889445 |
| Molecular Formula | C20H33N5O2Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | 4-[[6-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-2-pyridinyl]methyl]piperidin-4-ol |
| SMILES | C[Si](C)(C)CCOCn1ccc(Nc2cccc(CC3(O)CCNCC3)n2)n1 |
| InChI | InChI=1S/C20H33N5O2Si/c1-28(2,3)14-13-27-16-25-12-7-19(24-25)23-18-6-4-5-17(22-18)15-20(26)8-10-21-11-9-20/h4-7,12,21,26H,8-11,13-16H2,1-3H3,(H,22,23,24) |
| InChIKey | VPIJIXQHQXSIEV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|