C35H41N5O3Si — CID 152925158
3-(cyclohexen-1-yl)-6-(4-methoxyphenyl)-2-phenyl-5-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-4H-pyrazolo[1,5-a]pyridin-7-one (PubChem CID 152925158) has the molecular formula C35H41N5O3Si and a molecular weight of 607.83 g/mol. Its IUPAC name is 3-(cyclohexen-1-yl)-6-(4-methoxyphenyl)-2-phenyl-5-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-4H-pyrazolo[1,5-a]pyridin-7-one.
| Compound Name | 3-(cyclohexen-1-yl)-6-(4-methoxyphenyl)-2-phenyl-5-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-4H-pyrazolo[1,5-a]pyridin-7-one |
|---|---|
| PubChem CID | 152925158 |
| Molecular Formula | C35H41N5O3Si |
| Molecular Weight | 607.83 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 3-(cyclohexen-1-yl)-6-(4-methoxyphenyl)-2-phenyl-5-[[1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]amino]-4H-pyrazolo[1,5-a]pyridin-7-one |
| SMILES | COc1ccc(C2=C(Nc3ccn(COCC[Si](C)(C)C)n3)Cc3c(C4=CCCCC4)c(-c4ccccc4)nn3C2=O)cc1 |
| InChI | InChI=1S/C35H41N5O3Si/c1-42-28-17-15-26(16-18-28)32-29(36-31-19-20-39(37-31)24-43-21-22-44(2,3)4)23-30-33(25-11-7-5-8-12-25)34(38-40(30)35(32)41)27-13-9-6-10-14-27/h6,9-11,13-20H,5,7-8,12,21-24H2,1-4H3,(H,36,37) |
| InChIKey | UJWDKLKDLRLDBY-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.83 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|