C15H21N5OSi — CID 175781519
trimethyl-[2-[[3-(triazolo[1,5-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 175781519) has the molecular formula C15H21N5OSi and a molecular weight of 315.45 g/mol. Its IUPAC name is trimethyl-[2-[[3-(triazolo[1,5-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[3-(triazolo[1,5-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 175781519 |
| Molecular Formula | C15H21N5OSi |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | trimethyl-[2-[[3-(triazolo[1,5-a]pyridin-6-yl)pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc(-c2ccc3cnnn3c2)n1 |
| InChI | InChI=1S/C15H21N5OSi/c1-22(2,3)9-8-21-12-19-7-6-15(17-19)13-4-5-14-10-16-18-20(14)11-13/h4-7,10-11H,8-9,12H2,1-3H3 |
| InChIKey | HPVCTDFPHWUHKM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|