C32H36N6OSi — CID 135718580
2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4-ethyl-5-pyridin-4-yl-3-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 135718580) has the molecular formula C32H36N6OSi and a molecular weight of 548.77 g/mol. Its IUPAC name is 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4-ethyl-5-pyridin-4-yl-3-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4-ethyl-5-pyridin-4-yl-3-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 135718580 |
| Molecular Formula | C32H36N6OSi |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 2-[[3-(6,7-dihydro-1H-benzimidazol-2-yl)-5-(4-ethyl-5-pyridin-4-yl-3-pyridinyl)indazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCc1c(-c2ccncc2)cncc1-c1ccc2c(c1)c(-c1nc3c([nH]1)CCC=C3)nn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C32H36N6OSi/c1-5-24-26(22-12-14-33-15-13-22)19-34-20-27(24)23-10-11-30-25(18-23)31(32-35-28-8-6-7-9-29(28)36-32)37-38(30)21-39-16-17-40(2,3)4/h6,8,10-15,18-20H,5,7,9,16-17,21H2,1-4H3,(H,35,36) |
| InChIKey | GPAPOXCMBQQDCB-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|