C21H24N4O5 — CID 103596960
4-[2-[2-ethoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]ethyl]morpholine (PubChem CID 103596960) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[2-[2-ethoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]ethyl]morpholine.
| Compound Name | 4-[2-[2-ethoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]ethyl]morpholine |
|---|---|
| PubChem CID | 103596960 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-[2-[2-ethoxy-4-(6-nitro-1H-benzimidazol-2-yl)phenoxy]ethyl]morpholine |
| SMILES | CCOc1cc(-c2nc3ccc([N+](=O)[O-])cc3[nH]2)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C21H24N4O5/c1-2-29-20-13-15(3-6-19(20)30-12-9-24-7-10-28-11-8-24)21-22-17-5-4-16(25(26)27)14-18(17)23-21/h3-6,13-14H,2,7-12H2,1H3,(H,22,23) |
| InChIKey | NOEXSCFLHYIQPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|