C23H21ClN2O3 — CID 89227089
2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazole-5-carbaldehyde (PubChem CID 89227089) has the molecular formula C23H21ClN2O3 and a molecular weight of 408.89 g/mol. Its IUPAC name is 2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazole-5-carbaldehyde.
| Compound Name | 2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 89227089 |
| Molecular Formula | C23H21ClN2O3 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 2-[5-[(2-butoxy-5-chlorophenyl)methyl]furan-2-yl]-3H-benzimidazole-5-carbaldehyde |
| SMILES | CCCCOc1ccc(Cl)cc1Cc1ccc(-c2nc3ccc(C=O)cc3[nH]2)o1 |
| InChI | InChI=1S/C23H21ClN2O3/c1-2-3-10-28-21-8-5-17(24)12-16(21)13-18-6-9-22(29-18)23-25-19-7-4-15(14-27)11-20(19)26-23/h4-9,11-12,14H,2-3,10,13H2,1H3,(H,25,26) |
| InChIKey | IRVPGDZCGGYXLI-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|