C26H37N3O3 — CID 1148359
1-(1-benzylpiperidin-4-yl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 1148359) has the molecular formula C26H37N3O3 and a molecular weight of 439.60 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1148359 |
| Molecular Formula | C26H37N3O3 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.28 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(C3CCN(Cc4ccccc4)CC3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C26H37N3O3/c1-30-24-10-9-22(25(31-2)26(24)32-3)20-28-15-17-29(18-16-28)23-11-13-27(14-12-23)19-21-7-5-4-6-8-21/h4-10,23H,11-20H2,1-3H3 |
| InChIKey | ONIGSJFBMMCFCS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |