C26H33ClN2O6 — CID 163328429
N-benzyl-N-butyl-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid (PubChem CID 163328429) has the molecular formula C26H33ClN2O6 and a molecular weight of 505.01 g/mol. Its IUPAC name is N-benzyl-N-butyl-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid.
| Compound Name | N-benzyl-N-butyl-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328429 |
| Molecular Formula | C26H33ClN2O6 |
| Molecular Weight | 505.01 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-benzyl-N-butyl-1-[(5-chloro-2-hydroxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C1CCN(Cc2cc(Cl)ccc2O)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H31ClN2O2.C2H2O4/c1-2-3-13-27(17-19-7-5-4-6-8-19)24(29)20-11-14-26(15-12-20)18-21-16-22(25)9-10-23(21)28;3-1(4)2(5)6/h4-10,16,20,28H,2-3,11-15,17-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | SMRKZQFUJBDRHL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.01 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|