C26H31ClN4O2 — CID 26278045
N-[(1S)-1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 26278045) has the molecular formula C26H31ClN4O2 and a molecular weight of 467.01 g/mol. Its IUPAC name is N-[(1S)-1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 26278045 |
| Molecular Formula | C26H31ClN4O2 |
| Molecular Weight | 467.01 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | N-[(1S)-1-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccn(C)n1)[C@@H](Cc1ccccc1)C1CCN(Cc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C26H31ClN4O2/c1-29-13-12-23(28-29)26(33)30(2)24(16-19-6-4-3-5-7-19)20-10-14-31(15-11-20)18-21-17-22(27)8-9-25(21)32/h3-9,12-13,17,20,24,32H,10-11,14-16,18H2,1-2H3/t24-/m0/s1 |
| InChIKey | NDOSNVVMILEAKJ-DEOSSOPVSA-N |
| XLogP | 4.37 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.01 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|