C28H31FN4O2 — CID 42482332
N-[(1S)-1-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide (PubChem CID 42482332) has the molecular formula C28H31FN4O2 and a molecular weight of 474.58 g/mol. Its IUPAC name is N-[(1S)-1-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide.
| Compound Name | N-[(1S)-1-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 42482332 |
| Molecular Formula | C28H31FN4O2 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | N-[(1S)-1-[1-[(E)-3-(2-fluorophenyl)prop-2-enoyl]piperidin-4-yl]-2-phenylethyl]-N,1-dimethylpyrazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccn(C)n1)[C@@H](Cc1ccccc1)C1CCN(C(=O)/C=C/c2ccccc2F)CC1 |
| InChI | InChI=1S/C28H31FN4O2/c1-31-17-16-25(30-31)28(35)32(2)26(20-21-8-4-3-5-9-21)23-14-18-33(19-15-23)27(34)13-12-22-10-6-7-11-24(22)29/h3-13,16-17,23,26H,14-15,18-20H2,1-2H3/b13-12+/t26-/m0/s1 |
| InChIKey | LUGWXLXPICQDRS-JYSHFMIGSA-N |
| XLogP | 4.19 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|