C26H36N2O3 — CID 42236999
N-[(1R)-1-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,2-dimethylpropanamide (PubChem CID 42236999) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[(1R)-1-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,2-dimethylpropanamide.
| Compound Name | N-[(1R)-1-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 42236999 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[(1R)-1-[1-[(2-hydroxy-5-methoxyphenyl)methyl]piperidin-4-yl]-2-phenylethyl]-N,2-dimethylpropanamide |
| SMILES | COc1ccc(O)c(CN2CCC([C@@H](Cc3ccccc3)N(C)C(=O)C(C)C)CC2)c1 |
| InChI | InChI=1S/C26H36N2O3/c1-19(2)26(30)27(3)24(16-20-8-6-5-7-9-20)21-12-14-28(15-13-21)18-22-17-23(31-4)10-11-25(22)29/h5-11,17,19,21,24,29H,12-16,18H2,1-4H3/t24-/m1/s1 |
| InChIKey | CYOSHUDXGPHTFL-XMMPIXPASA-N |
| XLogP | 4.34 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|