C18H17Cl2N3O — CID 55766602
5-chloro-2-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-1,3-benzoxazole (PubChem CID 55766602) has the molecular formula C18H17Cl2N3O and a molecular weight of 362.26 g/mol. Its IUPAC name is 5-chloro-2-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-1,3-benzoxazole.
| Compound Name | 5-chloro-2-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 55766602 |
| Molecular Formula | C18H17Cl2N3O |
| Molecular Weight | 362.26 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 5-chloro-2-[1-[(6-chloro-3-pyridinyl)methyl]piperidin-4-yl]-1,3-benzoxazole |
| SMILES | Clc1ccc2oc(C3CCN(Cc4ccc(Cl)nc4)CC3)nc2c1 |
| InChI | InChI=1S/C18H17Cl2N3O/c19-14-2-3-16-15(9-14)22-18(24-16)13-5-7-23(8-6-13)11-12-1-4-17(20)21-10-12/h1-4,9-10,13H,5-8,11H2 |
| InChIKey | XHMNQMNJVUFDQD-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.26 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|