About (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one
(3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one (PubChem CID 94181962) has the molecular formula C17H19ClN2O3
and a molecular weight of 334.80 g/mol. Its IUPAC name is (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one.
Molecular Properties
| Compound Name | (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one |
| PubChem CID | 94181962 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@H](N2CCC(c3nc4cc(Cl)ccc4o3)CC2)C(=O)O1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-10-8-14(17(21)22-10)20-6-4-11(5-7-20)16-19-13-9-12(18)2-3-15(13)23-16/h2-3,9-11,14H,4-8H2,1H3/t10-,14+/m1/s1 |
| InChIKey | NSZLSMYZBHCMSF-YGRLFVJLSA-N |
| XLogP | 3.36 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one?
The IUPAC name of (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one (CID 94181962) is (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one.
What is the SMILES notation for (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one?
The canonical SMILES for (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one is C[C@@H]1C[C@H](N2CCC(c3nc4cc(Cl)ccc4o3)CC2)C(=O)O1.
What is the InChIKey of (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one?
The InChIKey is NSZLSMYZBHCMSF-YGRLFVJLSA-N. The full InChI is InChI=1S/C17H19ClN2O3/c1-10-8-14(17(21)22-10)20-6-4-11(5-7-20)16-19-13-9-12(18)2-3-15(13)23-16/h2-3,9-11,14H,4-8H2,1H3/t10-,14+/m1/s1.
What are the key properties of (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one?
(3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one has a molecular weight of 334.80 g/mol, XLogP of 3.36, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-3-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-5-methyloxolan-2-one is sourced from PubChem (CID 94181962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).