C22H20Cl2N4O4 — CID 55682272
2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 55682272) has the molecular formula C22H20Cl2N4O4 and a molecular weight of 475.33 g/mol. Its IUPAC name is 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 55682272 |
| Molecular Formula | C22H20Cl2N4O4 |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-[4-(2,4-dichlorobenzoyl)piperazin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CN3CCN(C(=O)c4ccc(Cl)cc4Cl)CC3)cc2C1=O |
| InChI | InChI=1S/C22H20Cl2N4O4/c1-26-20(30)15-5-3-14(11-17(15)21(26)31)25-19(29)12-27-6-8-28(9-7-27)22(32)16-4-2-13(23)10-18(16)24/h2-5,10-11H,6-9,12H2,1H3,(H,25,29) |
| InChIKey | HICCXTUUOWDSQO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|