C22H23N3O3 — CID 55551245
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(4-methylphenyl)pyrrolidin-1-yl]acetamide (PubChem CID 55551245) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(4-methylphenyl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(4-methylphenyl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55551245 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-[2-(4-methylphenyl)pyrrolidin-1-yl]acetamide |
| SMILES | Cc1ccc(C2CCCN2CC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-14-5-7-15(8-6-14)19-4-3-11-25(19)13-20(26)23-16-9-10-17-18(12-16)22(28)24(2)21(17)27/h5-10,12,19H,3-4,11,13H2,1-2H3,(H,23,26) |
| InChIKey | CPLGHOGBILKYMW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|