C14H18F3N3O3S — CID 24651183
1-(4-sulfamoylphenyl)-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 24651183) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is 1-(4-sulfamoylphenyl)-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-(4-sulfamoylphenyl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 24651183 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 1-(4-sulfamoylphenyl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)NC2CCC(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C14H18F3N3O3S/c15-14(16,17)9-1-3-10(4-2-9)19-13(21)20-11-5-7-12(8-6-11)24(18,22)23/h5-10H,1-4H2,(H2,18,22,23)(H2,19,20,21) |
| InChIKey | PBMLMDSWKQUXPK-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |