C24H26N2O4 — CID 108528317
N-[2-(3,4-diethoxyphenyl)ethyl]-N'-naphthalen-2-yloxamide (PubChem CID 108528317) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-N'-naphthalen-2-yloxamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-naphthalen-2-yloxamide |
|---|---|
| PubChem CID | 108528317 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-N'-naphthalen-2-yloxamide |
| SMILES | CCOc1ccc(CCNC(=O)C(=O)Nc2ccc3ccccc3c2)cc1OCC |
| InChI | InChI=1S/C24H26N2O4/c1-3-29-21-12-9-17(15-22(21)30-4-2)13-14-25-23(27)24(28)26-20-11-10-18-7-5-6-8-19(18)16-20/h5-12,15-16H,3-4,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | ZBBUYAKWSGOUHK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|