C15H14ClN3O6S — CID 9164873
2-(3-chlorophenoxy)-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide (PubChem CID 9164873) has the molecular formula C15H14ClN3O6S and a molecular weight of 399.81 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide.
| Compound Name | 2-(3-chlorophenoxy)-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9164873 |
| Molecular Formula | C15H14ClN3O6S |
| Molecular Weight | 399.81 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 2-(3-chlorophenoxy)-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)COc2cccc(Cl)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H14ClN3O6S/c1-10-5-6-13(8-14(10)19(21)22)26(23,24)18-17-15(20)9-25-12-4-2-3-11(16)7-12/h2-8,18H,9H2,1H3,(H,17,20) |
| InChIKey | RYBORVHFTSHENN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.81 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|