C14H17N3O5S — CID 9208051
2-[(1S)-cyclopent-2-en-1-yl]-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide (PubChem CID 9208051) has the molecular formula C14H17N3O5S and a molecular weight of 339.37 g/mol. Its IUPAC name is 2-[(1S)-cyclopent-2-en-1-yl]-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide.
| Compound Name | 2-[(1S)-cyclopent-2-en-1-yl]-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide |
|---|---|
| PubChem CID | 9208051 |
| Molecular Formula | C14H17N3O5S |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 2-[(1S)-cyclopent-2-en-1-yl]-N'-(4-methyl-3-nitrophenyl)sulfonylacetohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)NNC(=O)C[C@H]2C=CCC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O5S/c1-10-6-7-12(9-13(10)17(19)20)23(21,22)16-15-14(18)8-11-4-2-3-5-11/h2,4,6-7,9,11,16H,3,5,8H2,1H3,(H,15,18)/t11-/m0/s1 |
| InChIKey | XRRGTVHKVNTOSI-NSHDSACASA-N |
| XLogP | 1.57 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|