C12H10ClN3O6 — CID 175272274
N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide;hydrochloride (PubChem CID 175272274) has the molecular formula C12H10ClN3O6 and a molecular weight of 327.68 g/mol. Its IUPAC name is N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide;hydrochloride.
| Compound Name | N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide;hydrochloride |
|---|---|
| PubChem CID | 175272274 |
| Molecular Formula | C12H10ClN3O6 |
| Molecular Weight | 327.68 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide;hydrochloride |
| SMILES | Cl.O=C(NNC(=O)c1ccco1)c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H9N3O6.ClH/c16-9-4-3-7(6-8(9)15(19)20)11(17)13-14-12(18)10-2-1-5-21-10;/h1-6,16H,(H,13,17)(H,14,18);1H |
| InChIKey | YGQSDYZKLQGLGC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.68 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|