C19H16N4O6 — CID 152628740
3-[3-(aminomethyl)phenyl]-N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide (PubChem CID 152628740) has the molecular formula C19H16N4O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-[3-(aminomethyl)phenyl]-N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide.
| Compound Name | 3-[3-(aminomethyl)phenyl]-N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide |
|---|---|
| PubChem CID | 152628740 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[3-(aminomethyl)phenyl]-N'-(4-hydroxy-3-nitrobenzoyl)furan-2-carbohydrazide |
| SMILES | NCc1cccc(-c2ccoc2C(=O)NNC(=O)c2ccc(O)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H16N4O6/c20-10-11-2-1-3-12(8-11)14-6-7-29-17(14)19(26)22-21-18(25)13-4-5-16(24)15(9-13)23(27)28/h1-9,24H,10,20H2,(H,21,25)(H,22,26) |
| InChIKey | ZDBJONGORDRHJS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 160.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|