C26H21N3O7 — CID 70805956
N'-(4-hydroxy-3-nitrobenzoyl)-3-[4-[(4-methylphenoxy)methyl]phenyl]furan-2-carbohydrazide (PubChem CID 70805956) has the molecular formula C26H21N3O7 and a molecular weight of 487.47 g/mol. Its IUPAC name is N'-(4-hydroxy-3-nitrobenzoyl)-3-[4-[(4-methylphenoxy)methyl]phenyl]furan-2-carbohydrazide.
| Compound Name | N'-(4-hydroxy-3-nitrobenzoyl)-3-[4-[(4-methylphenoxy)methyl]phenyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 70805956 |
| Molecular Formula | C26H21N3O7 |
| Molecular Weight | 487.47 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | N'-(4-hydroxy-3-nitrobenzoyl)-3-[4-[(4-methylphenoxy)methyl]phenyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(OCc2ccc(-c3ccoc3C(=O)NNC(=O)c3ccc(O)c([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C26H21N3O7/c1-16-2-9-20(10-3-16)36-15-17-4-6-18(7-5-17)21-12-13-35-24(21)26(32)28-27-25(31)19-8-11-23(30)22(14-19)29(33)34/h2-14,30H,15H2,1H3,(H,27,31)(H,28,32) |
| InChIKey | BTGUVNBWMLTDRT-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 143.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|