C24H23N3O9 — CID 88986085
N'-[4-(methoxymethoxy)-3-nitrobenzoyl]-3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]furan-2-carbohydrazide (PubChem CID 88986085) has the molecular formula C24H23N3O9 and a molecular weight of 497.46 g/mol. Its IUPAC name is N'-[4-(methoxymethoxy)-3-nitrobenzoyl]-3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]furan-2-carbohydrazide.
| Compound Name | N'-[4-(methoxymethoxy)-3-nitrobenzoyl]-3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 88986085 |
| Molecular Formula | C24H23N3O9 |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | N'-[4-(methoxymethoxy)-3-nitrobenzoyl]-3-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]furan-2-carbohydrazide |
| SMILES | COCOc1ccc(C(=O)NNC(=O)c2occc2-c2ccc(C3(C)OCCO3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H23N3O9/c1-24(35-11-12-36-24)17-6-3-15(4-7-17)18-9-10-33-21(18)23(29)26-25-22(28)16-5-8-20(34-14-32-2)19(13-16)27(30)31/h3-10,13H,11-12,14H2,1-2H3,(H,25,28)(H,26,29) |
| InChIKey | LBQNGVRJRKBQQZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 151.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|