C20H16F3N3O3S — CID 25469578
N-[4-[[2-(trifluoromethyl)anilino]carbamoyl]phenyl]benzenesulfonamide (PubChem CID 25469578) has the molecular formula C20H16F3N3O3S and a molecular weight of 435.43 g/mol. Its IUPAC name is N-[4-[[2-(trifluoromethyl)anilino]carbamoyl]phenyl]benzenesulfonamide.
| Compound Name | N-[4-[[2-(trifluoromethyl)anilino]carbamoyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25469578 |
| Molecular Formula | C20H16F3N3O3S |
| Molecular Weight | 435.43 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | N-[4-[[2-(trifluoromethyl)anilino]carbamoyl]phenyl]benzenesulfonamide |
| SMILES | O=C(NNc1ccccc1C(F)(F)F)c1ccc(NS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16F3N3O3S/c21-20(22,23)17-8-4-5-9-18(17)24-25-19(27)14-10-12-15(13-11-14)26-30(28,29)16-6-2-1-3-7-16/h1-13,24,26H,(H,25,27) |
| InChIKey | ONPNOKBWLYXXCY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|