C27H21F3N4O2 — CID 139914006
N-phenyl-3-[4-[[2-(trifluoromethyl)anilino]carbamoyl]anilino]benzamide (PubChem CID 139914006) has the molecular formula C27H21F3N4O2 and a molecular weight of 490.49 g/mol. Its IUPAC name is N-phenyl-3-[4-[[2-(trifluoromethyl)anilino]carbamoyl]anilino]benzamide.
| Compound Name | N-phenyl-3-[4-[[2-(trifluoromethyl)anilino]carbamoyl]anilino]benzamide |
|---|---|
| PubChem CID | 139914006 |
| Molecular Formula | C27H21F3N4O2 |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | N-phenyl-3-[4-[[2-(trifluoromethyl)anilino]carbamoyl]anilino]benzamide |
| SMILES | O=C(NNc1ccccc1C(F)(F)F)c1ccc(Nc2cccc(C(=O)Nc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C27H21F3N4O2/c28-27(29,30)23-11-4-5-12-24(23)33-34-26(36)18-13-15-21(16-14-18)31-22-10-6-7-19(17-22)25(35)32-20-8-2-1-3-9-20/h1-17,31,33H,(H,32,35)(H,34,36) |
| InChIKey | AFHAZOJMKSEPSF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|