C14H31IN4O2 — CID 111808767
tert-butyl N-[3-[[amino-(propan-2-ylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate;hydroiodide (PubChem CID 111808767) has the molecular formula C14H31IN4O2 and a molecular weight of 414.33 g/mol. Its IUPAC name is tert-butyl N-[3-[[amino-(propan-2-ylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate;hydroiodide.
| Compound Name | tert-butyl N-[3-[[amino-(propan-2-ylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate;hydroiodide |
|---|---|
| PubChem CID | 111808767 |
| Molecular Formula | C14H31IN4O2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | tert-butyl N-[3-[[amino-(propan-2-ylamino)methylidene]amino]-2-methylpropyl]-N-methylcarbamate;hydroiodide |
| SMILES | CC(C/N=C(\N)NC(C)C)CN(C)C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C14H30N4O2.HI/c1-10(2)17-12(15)16-8-11(3)9-18(7)13(19)20-14(4,5)6;/h10-11H,8-9H2,1-7H3,(H3,15,16,17);1H |
| InChIKey | FXAZJNAQLRRGAK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|