C10H21N3O3 — CID 75834024
tert-butyl N-(3-amino-3-hydroxyimino-2-methylpropyl)-N-methylcarbamate (PubChem CID 75834024) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is tert-butyl N-(3-amino-3-hydroxyimino-2-methylpropyl)-N-methylcarbamate.
| Compound Name | tert-butyl N-(3-amino-3-hydroxyimino-2-methylpropyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 75834024 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | tert-butyl N-(3-amino-3-hydroxyimino-2-methylpropyl)-N-methylcarbamate |
| SMILES | CC(CN(C)C(=O)OC(C)(C)C)C(N)=NO |
| InChI | InChI=1S/C10H21N3O3/c1-7(8(11)12-15)6-13(5)9(14)16-10(2,3)4/h7,15H,6H2,1-5H3,(H2,11,12) |
| InChIKey | IQFCEJTWEISRPL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|