C17H22N4O3S — CID 111094399
N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]thiophene-2-carboxamide (PubChem CID 111094399) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111094399 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[3-[[amino-(3,4-dimethoxyanilino)methylidene]amino]propyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(N/C(N)=N/CCCNC(=O)c2cccs2)cc1OC |
| InChI | InChI=1S/C17H22N4O3S/c1-23-13-7-6-12(11-14(13)24-2)21-17(18)20-9-4-8-19-16(22)15-5-3-10-25-15/h3,5-7,10-11H,4,8-9H2,1-2H3,(H,19,22)(H3,18,20,21) |
| InChIKey | PBKKTNJOKRLTEM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|