C30H53N2O14PS — CID 59728814
6-[3-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoyl]-2,4-dioxocyclopentyl]sulfanylhexoxy-methylphosphinic acid (PubChem CID 59728814) has the molecular formula C30H53N2O14PS and a molecular weight of 728.79 g/mol. Its IUPAC name is 6-[3-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoyl]-2,4-dioxocyclopentyl]sulfanylhexoxy-methylphosphinic acid.
| Compound Name | 6-[3-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoyl]-2,4-dioxocyclopentyl]sulfanylhexoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 59728814 |
| Molecular Formula | C30H53N2O14PS |
| Molecular Weight | 728.79 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | 6-[3-[2,6-bis[2-(2-methoxyethoxy)ethoxycarbonylamino]hexanoyl]-2,4-dioxocyclopentyl]sulfanylhexoxy-methylphosphinic acid |
| SMILES | COCCOCCOC(=O)NCCCCC(NC(=O)OCCOCCOC)C(=O)C1C(=O)CC(SCCCCCCOP(C)(=O)O)C1=O |
| InChI | InChI=1S/C30H53N2O14PS/c1-40-13-15-42-17-19-44-29(36)31-11-7-6-10-23(32-30(37)45-20-18-43-16-14-41-2)27(34)26-24(33)22-25(28(26)35)48-21-9-5-4-8-12-46-47(3,38)39/h23,25-26H,4-22H2,1-3H3,(H,31,36)(H,32,37)(H,38,39) |
| InChIKey | LRPAWDGNTQMUSK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 211.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.79 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|