C17H36NO6P — CID 21032461
tert-butyl N-[1-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]butan-2-yl]carbamate (PubChem CID 21032461) has the molecular formula C17H36NO6P and a molecular weight of 381.45 g/mol. Its IUPAC name is tert-butyl N-[1-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 21032461 |
| Molecular Formula | C17H36NO6P |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | tert-butyl N-[1-[bis[(2-methylpropan-2-yl)oxy]phosphoryloxy]butan-2-yl]carbamate |
| SMILES | CCC(COP(=O)(OC(C)(C)C)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H36NO6P/c1-11-13(18-14(19)22-15(2,3)4)12-21-25(20,23-16(5,6)7)24-17(8,9)10/h13H,11-12H2,1-10H3,(H,18,19) |
| InChIKey | JMVRYLRWDFNXSF-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|