C14H30N2O3 — CID 107250414
tert-butyl N-[1-(3-methoxybutan-2-ylamino)butan-2-yl]carbamate (PubChem CID 107250414) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is tert-butyl N-[1-(3-methoxybutan-2-ylamino)butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(3-methoxybutan-2-ylamino)butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107250414 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | tert-butyl N-[1-(3-methoxybutan-2-ylamino)butan-2-yl]carbamate |
| SMILES | CCC(CNC(C)C(C)OC)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H30N2O3/c1-8-12(9-15-10(2)11(3)18-7)16-13(17)19-14(4,5)6/h10-12,15H,8-9H2,1-7H3,(H,16,17) |
| InChIKey | XWARAIQIOYQIDU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |