C16H32N2O5 — CID 57434488
tert-butyl-[(5S)-6-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid (PubChem CID 57434488) has the molecular formula C16H32N2O5 and a molecular weight of 332.44 g/mol. Its IUPAC name is tert-butyl-[(5S)-6-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid.
| Compound Name | tert-butyl-[(5S)-6-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
|---|---|
| PubChem CID | 57434488 |
| Molecular Formula | C16H32N2O5 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | tert-butyl-[(5S)-6-hydroxy-5-[(2-methylpropan-2-yl)oxycarbonylamino]hexyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)CCCCN(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O5/c1-15(2,3)18(14(21)22)10-8-7-9-12(11-19)17-13(20)23-16(4,5)6/h12,19H,7-11H2,1-6H3,(H,17,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | RSMMWCYHZMGHOR-LBPRGKRZSA-N |
| XLogP | 2.82 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|