C27H37N3O10S — CID 144538562
2-(5,5-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)pentanedioic acid;6-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 144538562) has the molecular formula C27H37N3O10S and a molecular weight of 595.67 g/mol. Its IUPAC name is 2-(5,5-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)pentanedioic acid;6-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | 2-(5,5-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)pentanedioic acid;6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 144538562 |
| Molecular Formula | C27H37N3O10S |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.22 |
| IUPAC Name | 2-(5,5-diethyl-4,6-dioxo-2-sulfanylidene-1,3-diazinan-1-yl)pentanedioic acid;6-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CCC1(CC)C(=O)NC(=S)N(C(CCC(=O)O)C(=O)O)C1=O.O=C(O)CCCCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19NO4.C13H18N2O6S/c16-13(17)9-5-2-6-10-15-14(18)19-11-12-7-3-1-4-8-12;1-3-13(4-2)10(20)14-12(22)15(11(13)21)7(9(18)19)5-6-8(16)17/h1,3-4,7-8H,2,5-6,9-11H2,(H,15,18)(H,16,17);7H,3-6H2,1-2H3,(H,16,17)(H,18,19)(H,14,20,22) |
| InChIKey | FZHBWQYRFNEQCL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 199.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|