C23H28N4O11 — CID 78046860
2-[3-[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanedioic acid (PubChem CID 78046860) has the molecular formula C23H28N4O11 and a molecular weight of 536.49 g/mol. Its IUPAC name is 2-[3-[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanedioic acid.
| Compound Name | 2-[3-[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 78046860 |
| Molecular Formula | C23H28N4O11 |
| Molecular Weight | 536.49 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 2-[3-[1-carboxy-5-(phenylmethoxycarbonylamino)pentyl]-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]pentanedioic acid |
| SMILES | Cn1c(=O)n(C(CCCCNC(=O)OCc2ccccc2)C(=O)O)c(=O)n(C(CCC(=O)O)C(=O)O)c1=O |
| InChI | InChI=1S/C23H28N4O11/c1-25-21(35)26(23(37)27(22(25)36)16(19(32)33)10-11-17(28)29)15(18(30)31)9-5-6-12-24-20(34)38-13-14-7-3-2-4-8-14/h2-4,7-8,15-16H,5-6,9-13H2,1H3,(H,24,34)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | PTZVCGVOOPODDZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 216.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|