C18H22N2O7 — CID 70088370
(2S)-2-(3-methoxy-2,5-dioxopyrrolidin-1-yl)-5-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 70088370) has the molecular formula C18H22N2O7 and a molecular weight of 378.38 g/mol. Its IUPAC name is (2S)-2-(3-methoxy-2,5-dioxopyrrolidin-1-yl)-5-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-2-(3-methoxy-2,5-dioxopyrrolidin-1-yl)-5-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 70088370 |
| Molecular Formula | C18H22N2O7 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | (2S)-2-(3-methoxy-2,5-dioxopyrrolidin-1-yl)-5-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | COC1CC(=O)N(C(CCCNC(=O)OCc2ccccc2)C(=O)O)C1=O |
| InChI | InChI=1S/C18H22N2O7/c1-26-14-10-15(21)20(16(14)22)13(17(23)24)8-5-9-19-18(25)27-11-12-6-3-2-4-7-12/h2-4,6-7,13-14H,5,8-11H2,1H3,(H,19,25)(H,23,24) |
| InChIKey | SVQCMUPEBPIGGH-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|